CymitQuimica logo

CAS 955288-12-7

:

3-(5-fluoro-2-methylbenzyl)piperidine

Description:
3-(5-Fluoro-2-methylbenzyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The presence of a 5-fluoro-2-methylbenzyl group at the 3-position of the piperidine ring introduces specific functional properties, including potential biological activity. The fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets, while the methyl group may affect steric hindrance and electronic properties. This compound is likely to be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may confer specific pharmacological effects. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry for structural confirmation. As with many piperidine derivatives, it may exhibit properties such as analgesic or psychoactive effects, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with all chemical substances.
Formula:C13H18FN
InChI:InChI=1/C13H18FN/c1-10-4-5-13(14)8-12(10)7-11-3-2-6-15-9-11/h4-5,8,11,15H,2-3,6-7,9H2,1H3
SMILES:Cc1ccc(cc1CC1CCCNC1)F
Synonyms:
  • Piperidine, 3-[(5-Fluoro-2-Methylphenyl)Methyl]-
  • 3-(5-Fluoro-2-methylbenzyl)piperidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.