CymitQuimica logo

CAS 955288-19-4

:

3-(4-methoxy-3-methylbenzyl)piperidine

Description:
3-(4-Methoxy-3-methylbenzyl)piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a benzyl group substituted with a methoxy group and a methyl group at the para position relative to the benzyl carbon. This substitution pattern contributes to its unique chemical properties, including its potential for various interactions due to the presence of both hydrophobic and polar functional groups. The methoxy group enhances solubility in organic solvents and may influence the compound's biological activity. Additionally, the piperidine moiety can participate in hydrogen bonding and may affect the compound's pharmacokinetic properties. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system or other biological pathways. As with many organic compounds, its stability, reactivity, and interactions with other substances can be influenced by environmental factors such as pH and temperature.
Formula:C14H21NO
InChI:InChI=1/C14H21NO/c1-11-8-12(5-6-14(11)16-2)9-13-4-3-7-15-10-13/h5-6,8,13,15H,3-4,7,9-10H2,1-2H3
Synonyms:
  • 3-(4-Methoxy-3-methylbenzyl)piperidine
  • piperidine, 3-[(4-methoxy-3-methylphenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.