CAS 955288-26-3
:3-(4-phenoxybenzyl)piperidine
Description:
3-(4-Phenoxybenzyl)piperidine is an organic compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The compound features a phenoxybenzyl substituent at the 3-position of the piperidine ring, contributing to its unique chemical properties. This structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The presence of the phenoxy group may enhance lipophilicity, influencing its solubility and permeability in biological systems. Additionally, the compound may exhibit various pharmacological activities, potentially acting as a ligand for certain receptors or enzymes. Its molecular structure allows for various functional group modifications, which can be explored for developing derivatives with improved efficacy or selectivity. The compound's CAS number, 955288-26-3, facilitates its identification in chemical databases and literature. Overall, 3-(4-phenoxybenzyl)piperidine represents a versatile scaffold for further research and development in drug discovery and related fields.
Formula:C18H21NO
InChI:InChI=1/C18H21NO/c1-2-6-17(7-3-1)20-18-10-8-15(9-11-18)13-16-5-4-12-19-14-16/h1-3,6-11,16,19H,4-5,12-14H2
SMILES:c1ccc(cc1)Oc1ccc(cc1)CC1CCCNC1
Synonyms:- Piperidine, 3-[(4-Phenoxyphenyl)Methyl]-
- 3-(4-Phenoxybenzyl)piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.