CAS 955288-40-1

2-[(3-fluoro-4-methoxy-phenyl)methyl]piperidine

Description:

2-[(3-Fluoro-4-methoxy-phenyl)methyl]piperidine, identified by its CAS number 955288-40-1, is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This compound features a phenyl group substituted with a fluorine atom and a methoxy group at the para position relative to the piperidine attachment. The presence of the fluorine atom can influence the compound's electronic properties and lipophilicity, potentially affecting its biological activity. The methoxy group may enhance solubility and stability. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that may interact with biological targets. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be studied using various analytical methods such as NMR, mass spectrometry, and chromatography. Overall, the unique combination of functional groups in 2-[(3-fluoro-4-methoxy-phenyl)methyl]piperidine suggests potential applications in drug discovery and development.

Formula: C₁₃H₁₈FNO

InChI: InChI=1/C13H18FNO/c1-16-13-6-5-10(9-12(13)14)8-11-4-2-3-7-15-11/h5-6,9,11,15H,2-4,7-8H2,1H3

SMILES: COc1ccc(CC2CCCCN2)cc1F

Synonyms:

• 2-(3-Fluoro-4-methoxybenzyl)piperidine
• Piperidine, 2-[(3-Fluoro-4-Methoxyphenyl)Methyl]-

2-(3-Fluoro-4-methoxybenzyl)piperidine

Controlled Product

CAS: 955288-40-1

Please enquire for more information about 2-(3-Fluoro-4-methoxybenzyl)piperidine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₃H₁₈FNO

Purity: Min. 95%

Molecular weight: 223.29 g/mol

Ref: 3D-FF84658