CAS 955288-46-7

2-[(3-fluorophenyl)methyl]piperidine

Description:

2-[(3-Fluorophenyl)methyl]piperidine is an organic compound characterized by its piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 3-fluorophenyl group attached to the piperidine via a methylene bridge contributes to its unique properties. This compound typically exhibits moderate to high lipophilicity due to the aromatic fluorophenyl substituent, which can influence its biological activity and solubility in organic solvents. The fluorine atom can enhance the compound's metabolic stability and alter its interaction with biological targets. As a piperidine derivative, it may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of potential therapeutic agents. The compound's molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be significant in drug design. Overall, 2-[(3-fluorophenyl)methyl]piperidine is a compound of interest in both synthetic and medicinal chemistry due to its structural features and potential applications.

Formula: C₁₂H₁₆FN

InChI: InChI=1/C12H16FN/c13-11-5-3-4-10(8-11)9-12-6-1-2-7-14-12/h3-5,8,12,14H,1-2,6-7,9H2

SMILES: C1CCNC(C1)Cc1cccc(c1)F

Synonyms:

• 2-(3-Fluorobenzyl)piperidine
• Piperidine, 2-[(3-Fluorophenyl)Methyl]-

2-(3-Fluorobenzyl)piperidine

Controlled Product

CAS: 955288-46-7

Please enquire for more information about 2-(3-Fluorobenzyl)piperidine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₂H₁₆FN

Purity: Min. 95%

Molecular weight: 193.26 g/mol

Ref: 3D-FF79075