CAS 955314-95-1

3-(1,3-benzodioxol-5-ylmethyl)piperidine

Description:

3-(1,3-benzodioxol-5-ylmethyl)piperidine, identified by its CAS number 955314-95-1, is a chemical compound that features a piperidine ring substituted with a benzodioxole moiety. This structure imparts unique characteristics to the compound, including potential biological activity due to the presence of the benzodioxole, which is often associated with various pharmacological effects. The piperidine ring contributes to the compound's basicity and potential interactions with biological targets, such as receptors or enzymes. The compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting the hydrophobic nature of the benzodioxole group. Its synthesis typically involves the reaction of piperidine with a suitable benzodioxole derivative. Given its structural features, this compound may be of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities, toxicity, and safety profiles would require further investigation through empirical studies.

Formula: C₁₃H₁₇NO₂

InChI: InChI=1/C13H17NO2/c1-2-11(8-14-5-1)6-10-3-4-12-13(7-10)16-9-15-12/h3-4,7,11,14H,1-2,5-6,8-9H2

SMILES: C1CC(Cc2ccc3c(c2)OCO3)CNC1

Synonyms:

• Piperidine, 3-(1,3-Benzodioxol-5-Ylmethyl)-

3-Benzo[1,3]dioxol-5-ylmethyl-piperidine

CAS: 955314-95-1

3-Benzo[1,3]dioxol-5-ylmethyl-piperidine

Purity: ≥95%

Molecular weight: 219.28g/mol

Ref: 54-OR307735