CAS 955315-01-2

4-(4-phenoxybenzyl)piperidine

Description:

4-(4-phenoxybenzyl)piperidine is an organic compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The structure features a phenoxybenzyl group attached to the piperidine nitrogen, contributing to its unique chemical properties. This compound is typically classified as an amine due to the presence of the piperidine ring, which can participate in various chemical reactions, including nucleophilic substitutions and alkylations. It may exhibit moderate to high lipophilicity, influencing its solubility in organic solvents and potential bioactivity. The presence of the phenoxy group can enhance its interaction with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound may possess specific pharmacological properties, although detailed studies would be necessary to elucidate its biological activity and potential applications. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₈H₂₁NO

InChI: InChI=1/C18H21NO/c1-2-4-17(5-3-1)20-18-8-6-15(7-9-18)14-16-10-12-19-13-11-16/h1-9,16,19H,10-14H2

SMILES: c1ccc(cc1)Oc1ccc(cc1)CC1CCNCC1

Synonyms:

• Piperidine, 4-[(4-Phenoxyphenyl)Methyl]-
• 4-(4-Phenoxybenzyl)piperidine