CymitQuimica logo

CAS 955315-04-5

:

3-[(4-ethoxyphenyl)methyl]piperidine

Description:
3-[(4-Ethoxyphenyl)methyl]piperidine is an organic compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing ring. The structure features a 4-ethoxyphenyl group attached to the piperidine at the 3-position, contributing to its unique properties. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic nature due to the ethoxy and phenyl substituents. It may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the piperidine ring suggests potential interactions with biological targets, such as neurotransmitter receptors. Additionally, the ethoxy group can influence the compound's lipophilicity and metabolic stability. As with many organic compounds, safety and handling precautions should be observed, as its specific toxicity and environmental impact would depend on further empirical studies. Overall, 3-[(4-ethoxyphenyl)methyl]piperidine represents a class of compounds that can be explored for various applications in chemical and pharmaceutical research.
Formula:C14H21NO
InChI:InChI=1/C14H21NO/c1-2-16-14-7-5-12(6-8-14)10-13-4-3-9-15-11-13/h5-8,13,15H,2-4,9-11H2,1H3
SMILES:CCOc1ccc(cc1)CC1CCCNC1
Synonyms:
  • 3-(4-Ethoxybenzyl)piperidine
  • Piperidine, 3-[(4-Ethoxyphenyl)Methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.