CAS 955315-13-6
:3-(4-fluoro-2-methylbenzyl)piperidine
Description:
3-(4-Fluoro-2-methylbenzyl)piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing five carbon atoms and one nitrogen atom. The presence of a 4-fluoro-2-methylbenzyl group at the third position of the piperidine ring introduces specific functional characteristics, including potential variations in polarity and reactivity due to the fluorine and methyl substituents. The fluorine atom can enhance the compound's lipophilicity and influence its biological activity, while the methyl group may affect steric hindrance and electronic properties. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as modifications to the piperidine structure can lead to diverse pharmacological profiles. Additionally, its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in drug discovery. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C13H18FN
InChI:InChI=1/C13H18FN/c1-10-7-13(14)5-4-12(10)8-11-3-2-6-15-9-11/h4-5,7,11,15H,2-3,6,8-9H2,1H3
SMILES:Cc1cc(ccc1CC1CCCNC1)F
Synonyms:- Piperidine, 3-[(4-Fluoro-2-Methylphenyl)Methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.