CAS 955315-21-6

2-[[3-methoxy-5-(trifluoromethyl)phenyl]methyl]piperidine

Description:

2-[[3-Methoxy-5-(trifluoromethyl)phenyl]methyl]piperidine is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. The compound features a phenyl group substituted with a methoxy group and a trifluoromethyl group, contributing to its unique chemical properties. The presence of the trifluoromethyl group enhances lipophilicity and can influence the compound's biological activity, making it of interest in pharmaceutical research. The methoxy group can also affect the compound's solubility and reactivity. This compound is typically studied for its potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its molecular structure suggests it may interact with various biological targets, and its specific characteristics, such as melting point, boiling point, and solubility, would be determined through experimental methods. Overall, 2-[[3-methoxy-5-(trifluoromethyl)phenyl]methyl]piperidine represents a class of compounds that may exhibit significant pharmacological properties.

Formula: C₁₄H₁₈F₃NO

InChI: InChI=1/C14H18F3NO/c1-19-13-8-10(6-11(9-13)14(15,16)17)7-12-4-2-3-5-18-12/h6,8-9,12,18H,2-5,7H2,1H3

SMILES: COc1cc(cc(c1)C(F)(F)F)CC1CCCCN1

Synonyms:

• 2-[3-Methoxy-5-(trifluoromethyl)benzyl]piperidine
• Piperidine, 2-[[3-Methoxy-5-(Trifluoromethyl)Phenyl]Methyl]-

2-[3-Methoxy-5-(trifluoromethyl)benzyl]piperidine

Controlled Product

CAS: 955315-21-6

Please enquire for more information about 2-[3-Methoxy-5-(trifluoromethyl)benzyl]piperidine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₄H₁₈F₃NO

Purity: Min. 95%

Molecular weight: 273.29 g/mol

Ref: 3D-FM91813