CAS 955315-33-0

6-{[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl}pyridin-3-ol

Description:

6-{[2,8-bis(trifluoromethyl)quinolin-4-yl]methyl}pyridin-3-ol is a chemical compound characterized by its complex structure, which includes a pyridin-3-ol moiety and a quinoline derivative with trifluoromethyl groups. The presence of the trifluoromethyl groups enhances the lipophilicity and biological activity of the compound, making it of interest in medicinal chemistry. The hydroxyl group in the pyridine ring contributes to its potential as a ligand in coordination chemistry and may influence its solubility and reactivity. This compound may exhibit various biological activities, including antimicrobial or anticancer properties, due to the quinoline framework, which is known for its pharmacological significance. Additionally, the compound's unique structure may allow for specific interactions with biological targets, making it a candidate for further research in drug development. Its CAS number, 955315-33-0, allows for easy identification and reference in chemical databases. Overall, this compound represents a fascinating area of study in the intersection of organic chemistry and pharmacology.

Formula: C₁₇H₁₀F₆N₂O

InChI: InChI=1/C17H10F6N2O/c18-16(19,20)13-3-1-2-12-9(6-10-4-5-11(26)8-24-10)7-14(17(21,22)23)25-15(12)13/h1-5,7-8,26H,6H2

SMILES: c1cc2c(Cc3ccc(cn3)O)cc(C(F)(F)F)nc2c(c1)C(F)(F)F

6-(2,8-Bis-trifluoromethyl-quinolin-4-ylmethyl)-pyridin-3-ol

CAS: 955315-33-0

6-(2,8-Bis-trifluoromethyl-quinolin-4-ylmethyl)-pyridin-3-ol

Purity: ≥95%

Molecular weight: 372.26g/mol

Ref: 54-PC404549