CAS 955328-43-5

ethyl 4-amino-8-chloro-quinoline-3-carboxylate

Description:

Ethyl 4-amino-8-chloro-quinoline-3-carboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features an ethyl ester functional group, an amino group, and a chloro substituent, contributing to its potential biological activity. The presence of the amino group suggests it may participate in hydrogen bonding, enhancing its solubility in polar solvents. The chloro group can influence the compound's reactivity and stability, while the carboxylate moiety may play a role in interactions with biological targets. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as quinoline derivatives are known for various pharmacological properties, including antimicrobial and antimalarial activities. Its specific properties, such as melting point, solubility, and spectral characteristics, would typically be determined through experimental methods and may vary based on the conditions of synthesis and purification.

Formula: C₁₂H₁₁ClN₂O₂

InChI: InChI=1/C12H11ClN2O2/c1-2-17-12(16)8-6-15-11-7(10(8)14)4-3-5-9(11)13/h3-6H,2H2,1H3,(H2,14,15)

SMILES: CCOC(=O)c1cnc2c(cccc2Cl)c1N

Synonyms:

• 3-Quinolinecarboxylic acid, 4-amino-8-chloro-, ethyl ester
• Ethyl 4-Amino-8-Chloroquinoline-3-Carboxylate