CymitQuimica logo

CAS 955366-07-1

:

1,2-Dihydro-1-[6-(1-hydroxy-1-methylethyl)-2-pyridinyl]-6-[[4-(1-piperazinyl)phenyl]amino]-2-(2-propen-1-yl)-3H-pyrazolo[3,4-d]pyrimidin-3-one

Description:
1,2-Dihydro-1-[6-(1-hydroxy-1-methylethyl)-2-pyridinyl]-6-[[4-(1-piperazinyl)phenyl]amino]-2-(2-propen-1-yl)-3H-pyrazolo[3,4-d]pyrimidin-3-one, with CAS number 955366-07-1, is a synthetic organic compound characterized by its complex molecular structure, which includes multiple functional groups such as a pyrazolo-pyrimidine core, a piperazine moiety, and a pyridine ring. This compound exhibits potential pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its structure suggests possible interactions with biological targets, which may include enzymes or receptors involved in various physiological processes. The presence of substituents like the hydroxy group and the propenyl chain may influence its solubility, stability, and bioactivity. Additionally, the compound's molecular weight, polarity, and stereochemistry are critical factors that determine its behavior in biological systems and its suitability for drug formulation. Further studies, including in vitro and in vivo evaluations, would be necessary to fully understand its pharmacodynamics and pharmacokinetics.
Formula:C26H30N8O2
InChI:InChI=1S/C26H30N8O2/c1-4-14-33-24(35)20-17-28-25(29-18-8-10-19(11-9-18)32-15-12-27-13-16-32)31-23(20)34(33)22-7-5-6-21(30-22)26(2,3)36/h4-11,17,27,36H,1,12-16H2,2-3H3,(H,28,29,31)
InChI key:InChIKey=MPKYJUACTUTJRY-UHFFFAOYSA-N
SMILES:C(C=C)N1N(C=2C(C1=O)=CN=C(NC3=CC=C(C=C3)N4CCNCC4)N2)C=5N=C(C(C)(C)O)C=CC5
Synonyms:
  • 1,2-Dihydro-1-[6-(1-hydroxy-1-methylethyl)-2-pyridinyl]-6-[[4-(1-piperazinyl)phenyl]amino]-2-(2-propen-1-yl)-3H-pyrazolo[3,4-d]pyrimidin-3-one
  • 3H-Pyrazolo[3,4-d]pyrimidin-3-one, 1,2-dihydro-1-[6-(1-hydroxy-1-methylethyl)-2-pyridinyl]-6-[[4-(1-piperazinyl)phenyl]amino]-2-(2-propen-1-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.