CAS 95537-93-2
:Anisaldehyde-(7-13C)
Description:
Anisaldehyde-(7-13C), with the CAS number 95537-93-2, is a labeled isotopomer of anisaldehyde, which is an aromatic aldehyde characterized by the presence of a methoxy group (-OCH3) attached to a benzene ring. The "7-13C" designation indicates that one of the carbon atoms in the molecule has been replaced with the carbon-13 isotope, making it useful for various analytical applications, particularly in nuclear magnetic resonance (NMR) spectroscopy and metabolic studies. Anisaldehyde itself is known for its pleasant, sweet, and floral aroma, commonly used in the fragrance and flavor industries. The presence of the carbon-13 isotope allows for enhanced tracking and analysis of metabolic pathways in biological systems. In terms of physical properties, anisaldehyde typically exhibits a low boiling point and is soluble in organic solvents. Its reactivity is primarily attributed to the aldehyde functional group, which can participate in various chemical reactions, including condensation and oxidation. Overall, Anisaldehyde-(7-13C) serves as a valuable tool in both research and industrial applications.
Formula:C713CH8O2
InChI:InChI=1/C8H8O2/c1-10-8-4-2-7(6-9)3-5-8/h2-6H,1H3/i6+1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Anisaldehyde-13C
CAS:Controlled ProductApplications Labelled Anisaldehyde. Anisaldehyde is a metabolic product of the odoriferous fungus Lentinus lepidus. Anisaldehyde is used in perfumery and toilet soaps.
References Jenner, P.M., et al.: Food Cosmet. Toxicol., 2, 327 (1964), Randolph, J., et al.: J. Med. Chem., 52, 3174 (2009),Formula:C7CH8O2Color and Shape:NeatMolecular weight:143.096

