
CAS 955403-37-9
:1-Ethyl-3-methyl-1H-pyrazole-5-ethanamine
Description:
1-Ethyl-3-methyl-1H-pyrazole-5-ethanamine, with the CAS number 955403-37-9, is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features an ethyl group and a methyl group attached to the pyrazole ring, as well as an ethanamine functional group, which contributes to its reactivity and potential biological activity. It is typically a colorless to light yellow liquid or solid, depending on its purity and form. The presence of the amine group suggests that it may engage in hydrogen bonding, influencing its solubility and interaction with other molecules. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could impart specific pharmacological properties. Its synthesis and applications are subjects of ongoing research, particularly in the context of developing new therapeutic agents. As with many organic compounds, safety data should be consulted before handling, as it may pose health risks.
Formula:C8H15N3
InChI:InChI=1S/C8H15N3/c1-3-11-8(4-5-9)6-7(2)10-11/h6H,3-5,9H2,1-2H3
InChI key:InChIKey=RFVGVUYAVQYQOR-UHFFFAOYSA-N
SMILES:C(CN)C=1N(CC)N=C(C)C1
Synonyms:- 2-(2-Ethyl-5-methylpyrazol-3-yl)ethanamine
- 2-(2-Ethyl-5-methyl-2H-pyrazol-3-yl)-ethylamine
- 1H-Pyrazole-5-ethanamine, 1-ethyl-3-methyl-
- 2-(1-Ethyl-3-methyl-1H-pyrazol-5-yl)ethanamine
- 1-Ethyl-3-methyl-1H-pyrazole-5-ethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.