CymitQuimica logo

CAS 955403-51-7

:

3-Fluoro-4-methylbenzenepropanal

Description:
3-Fluoro-4-methylbenzenepropanal, also known by its CAS number 955403-51-7, is an organic compound characterized by its structure, which includes a propanal group attached to a benzene ring that has both a fluorine atom and a methyl group as substituents. The presence of the fluorine atom introduces unique properties, such as increased lipophilicity and potential reactivity in various chemical reactions, making it of interest in medicinal chemistry and materials science. The methyl group contributes to the compound's hydrophobic characteristics, while the aldehyde functional group (propanal) is known for its reactivity, particularly in nucleophilic addition reactions. This compound may exhibit distinct physical properties, including boiling and melting points, which are influenced by its molecular structure and the presence of functional groups. Additionally, its potential applications could range from serving as an intermediate in organic synthesis to being explored for biological activity, depending on the specific context of research or industrial use.
Formula:C10H11FO
InChI:InChI=1S/C10H11FO/c1-8-4-5-9(3-2-6-12)7-10(8)11/h4-7H,2-3H2,1H3
InChI key:InChIKey=ORDCIMNPEHUMOL-UHFFFAOYSA-N
SMILES:C(CC=O)C1=CC(F)=C(C)C=C1
Synonyms:
  • 3-(3-Fluoro-4-methylphenyl)propionaldehyde
  • 3-Fluoro-4-methylbenzenepropanal
  • Benzenepropanal, 3-fluoro-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.