CAS 955403-52-8

2,4-Difluoro-3-methylbenzenepropanal

Description:

2,4-Difluoro-3-methylbenzenepropanal, with the CAS number 955403-52-8, is an organic compound characterized by its structure, which includes a benzene ring substituted with two fluorine atoms and a methyl group, along with a propanal functional group. The presence of fluorine atoms typically imparts unique properties such as increased lipophilicity and altered reactivity compared to non-fluorinated analogs. This compound may exhibit a range of physical properties, including a specific boiling point and melting point, which are influenced by its molecular structure and the presence of electronegative fluorine atoms. Additionally, it may show interesting chemical behavior in reactions, particularly in electrophilic aromatic substitution due to the electron-withdrawing nature of the fluorine substituents. The compound's applications could span various fields, including pharmaceuticals, agrochemicals, or materials science, depending on its reactivity and biological activity. However, specific data regarding its toxicity, stability, and environmental impact would require further investigation and analysis.

Formula: C₁₀H₁₀F₂O

InChI: InChI=1S/C10H10F2O/c1-7-9(11)5-4-8(10(7)12)3-2-6-13/h4-6H,2-3H2,1H3

InChI key: InChIKey=VUSNHZJBQUSJPQ-UHFFFAOYSA-N

SMILES: C(CC=O)C1=C(F)C(C)=C(F)C=C1

Synonyms:

• 2,4-Difluoro-3-methylbenzenepropanal
• Benzenepropanal, 2,4-difluoro-3-methyl-
• 3-(2,4-Difluoro-3-methylphenyl)propionaldehyde