CymitQuimica logo

CAS 955403-55-1

:

2-Fluoro-3-(trifluoromethyl)benzenepropanal

Description:
2-Fluoro-3-(trifluoromethyl)benzenepropanal, with the CAS number 955403-55-1, is an organic compound characterized by its unique functional groups and molecular structure. It features a benzene ring substituted with a fluorine atom at the 2-position and a trifluoromethyl group at the 3-position, along with an aldehyde functional group (propanal) attached to the benzene. This compound is likely to exhibit significant polarity due to the presence of the electronegative fluorine atoms, which can influence its reactivity and interactions with other molecules. The trifluoromethyl group is known for imparting unique electronic properties, making the compound potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. Additionally, the presence of the aldehyde group suggests that it may participate in typical reactions associated with aldehydes, such as nucleophilic addition. Overall, the combination of these functional groups contributes to the compound's distinctive chemical behavior and potential utility in synthetic chemistry.
Formula:C10H8F4O
InChI:InChI=1S/C10H8F4O/c11-9-7(4-2-6-15)3-1-5-8(9)10(12,13)14/h1,3,5-6H,2,4H2
InChI key:InChIKey=KGYBRSYEFVWNEZ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(F)C(CCC=O)=CC=C1
Synonyms:
  • Benzenepropanal, 2-fluoro-3-(trifluoromethyl)-
  • 2-Fluoro-3-(trifluoromethyl)benzenepropanal
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.