CymitQuimica logo

CAS 955403-56-2

:

3-Fluoro-5-(trifluoromethyl)benzenepropanal

Description:
3-Fluoro-5-(trifluoromethyl)benzenepropanal, with the CAS number 955403-56-2, is an organic compound characterized by its unique functional groups and structural features. It contains a benzene ring substituted with a fluorine atom at the meta position and a trifluoromethyl group at the para position, which significantly influences its chemical reactivity and physical properties. The presence of the aldehyde functional group (propanal) introduces reactivity typical of aldehydes, such as susceptibility to oxidation and participation in nucleophilic addition reactions. This compound is likely to exhibit moderate polarity due to the electronegative fluorine atoms, which can affect its solubility in various solvents. Additionally, the trifluoromethyl group is known for imparting unique electronic properties, potentially enhancing the compound's lipophilicity and biological activity. Overall, 3-Fluoro-5-(trifluoromethyl)benzenepropanal is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or agrochemicals due to its distinctive structural characteristics.
Formula:C10H8F4O
InChI:InChI=1S/C10H8F4O/c11-9-5-7(2-1-3-15)4-8(6-9)10(12,13)14/h3-6H,1-2H2
InChI key:InChIKey=FMBQBEDKXDYJPA-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(CCC=O)=CC(F)=C1
Synonyms:
  • Benzenepropanal, 3-fluoro-5-(trifluoromethyl)-
  • 3-Fluoro-5-(trifluoromethyl)benzenepropanal
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.