CAS 955403-58-4

2,3-Difluorobenzenepropanal

Description:

2,3-Difluorobenzenepropanal is an organic compound characterized by the presence of a propanal group attached to a benzene ring that has two fluorine substituents at the 2 and 3 positions. This compound belongs to the class of aromatic aldehydes, which are known for their distinctive reactivity due to the presence of the aldehyde functional group (-CHO) and the electron-withdrawing effects of the fluorine atoms. The fluorine substituents can influence the compound's physical and chemical properties, such as increasing its polarity and potentially affecting its boiling and melting points compared to non-fluorinated analogs. Additionally, the presence of fluorine can enhance the compound's stability and reactivity in various chemical reactions, making it of interest in synthetic organic chemistry and materials science. Its unique structure may also impart specific biological activities, which could be relevant in pharmaceutical applications. As with many fluorinated compounds, safety and handling considerations are important due to the potential toxicity and environmental impact of fluorinated substances.

Formula: C₉H₈F₂O

InChI: InChI=1/C9H8F2O/c10-8-5-1-3-7(9(8)11)4-2-6-12/h1,3,5-6H,2,4H2

InChI key: InChIKey=MLFAXWFAEODEGU-UHFFFAOYSA-N

SMILES: C(CC=O)C1=C(F)C(F)=CC=C1

Synonyms:

• 3-(2,3-Difluorphenyl)propanal
• Benzenepropanal, 2,3-difluoro-
• 2,3-Difluorobenzenepropanal