CymitQuimica logo

CAS 955403-64-2

:

2-Fluoro-3-methylbenzenepropanol

Description:
2-Fluoro-3-methylbenzenepropanol, also known by its CAS number 955403-64-2, is an organic compound characterized by the presence of a fluorine atom, a methyl group, and a propanol functional group attached to a benzene ring. This compound features a fluorinated aromatic system, which can influence its reactivity and physical properties, such as polarity and solubility. The presence of the hydroxyl (-OH) group in the propanol moiety contributes to its potential as a hydrogen bond donor, affecting its interactions with other molecules. Typically, compounds like this may exhibit moderate volatility and can be soluble in polar solvents due to the hydroxyl group. The fluorine substituent can enhance the compound's stability and alter its electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on further studies and assessments.
Formula:C10H13FO
InChI:InChI=1S/C10H13FO/c1-8-4-2-5-9(10(8)11)6-3-7-12/h2,4-5,12H,3,6-7H2,1H3
InChI key:InChIKey=XMIUGYZDISYKER-UHFFFAOYSA-N
SMILES:C(CCO)C1=C(F)C(C)=CC=C1
Synonyms:
  • 2-Fluoro-3-methylbenzenepropanol
  • Benzenepropanol, 2-fluoro-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.