CAS 95545-03-2
:1-(5-Amino-2,3-dihydro-2-methyl-1H-indol-1-yl)ethanone
Description:
1-(5-Amino-2,3-dihydro-2-methyl-1H-indol-1-yl)ethanone, with the CAS number 95545-03-2, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features an amino group and an ethanone moiety, contributing to its reactivity and potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and act as a nucleophile in various chemical reactions. The dihydroindole framework indicates that it may exhibit unique stereochemical properties, influencing its interactions in biological systems. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, particularly in the development of therapeutic agents. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, 1-(5-Amino-2,3-dihydro-2-methyl-1H-indol-1-yl)ethanone represents a class of compounds that could be explored for various applications in drug discovery and development.
Formula:C11H14N2O
InChI:InChI=1S/C11H14N2O/c1-7-5-9-6-10(12)3-4-11(9)13(7)8(2)14/h3-4,6-7H,5,12H2,1-2H3
InChI key:InChIKey=AMGUMEGDMJDXLL-UHFFFAOYSA-N
SMILES:C(C)(=O)N1C=2C(CC1C)=CC(N)=CC2
Synonyms:- 1-(5-Amino-2-methyl-2,3-dihydro-1H-indol-1-yl)ethan-1-one
- 1-(5-Amino-2,3-dihydro-2-methyl-1H-indol-1-yl)ethanone
- Ethanone, 1-(5-amino-2,3-dihydro-2-methyl-1H-indol-1-yl)-
- 1-(5-Amino-2-methylindolin-1-yl)ethanone
- 1H-Indol-5-amine, 1-acetyl-2,3-dihydro-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.