CAS 95574-95-1

N-Acetyl-2,7-anhydro-α-neuraminic acid

Description:

N-Acetyl-2,7-anhydro-α-neuraminic acid, commonly referred to as a derivative of sialic acid, is a naturally occurring amino sugar that plays a crucial role in cellular recognition and signaling processes. This compound is characterized by its unique structure, which includes a 2,7-anhydro configuration that contributes to its stability and biological activity. It typically exhibits a polar nature due to the presence of hydroxyl and amine functional groups, making it soluble in water and other polar solvents. The acetyl group enhances its stability and influences its interactions with proteins and other biomolecules. N-Acetyl-2,7-anhydro-α-neuraminic acid is significant in various biological processes, including cell adhesion and pathogen recognition, and is often studied for its potential applications in immunology and vaccine development. Its CAS number, 95574-95-1, is used for identification in chemical databases and regulatory contexts. Overall, this compound is an important subject of research in biochemistry and molecular biology due to its functional roles in living organisms.

Formula: C₁₁H₁₇NO₈

InChI: InChI=1S/C11H17NO8/c1-4(14)12-7-5(15)2-11(10(17)18)19-8(6(16)3-13)9(7)20-11/h5-9,13,15-16H,2-3H2,1H3,(H,12,14)(H,17,18)/t5-,6+,7+,8+,9+,11+/m0/s1

InChI key: InChIKey=NCMJSVDTRDLWJE-YRMXFSIDSA-N

SMILES: C(O)(=O)[C@]12O[C@]([C@@H](CO)O)([C@](O1)([C@H](NC(C)=O)[C@@H](O)C2)[H])[H]

Synonyms:

• N-Acetyl-2,7-anhydro-α-neuraminic acid
• 2,7-Anhydro-N-acetyl-α-neuraminic acid
• D-glycero-α-D-galacto-2-Nonulopyranosonic acid, 5-(acetylamino)-2,7-anhydro-3,5-dideoxy-
• α-Neuraminic acid, N-acetyl-2,7-anhydro-