CAS 95581-07-0

(2R,3S,4R,5R,6S)-2-azido-6-methyltetrahydro-2H-pyran-3,4,5-triyl triacetate (non-preferred name)

Description:

The chemical substance known as (2R,3S,4R,5R,6S)-2-azido-6-methyltetrahydro-2H-pyran-3,4,5-triyl triacetate, with the CAS number 95581-07-0, is a complex organic compound characterized by its azido functional group and multiple acetate ester groups. This compound features a tetrahydropyran ring, which contributes to its cyclic structure and stereochemistry, indicated by the specific R and S configurations at various carbon centers. The presence of the azido group (-N3) suggests potential reactivity, particularly in click chemistry applications, while the triacetate moiety enhances its solubility and stability in organic solvents. The stereochemistry of the molecule plays a crucial role in determining its biological activity and interaction with other molecules. Overall, this compound is of interest in synthetic organic chemistry and may have applications in medicinal chemistry or materials science due to its unique structural features and functional groups.

Formula: C₁₂H₁₇N₃O₇

InChI: InChI=1/C12H17N3O7/c1-5-9(20-6(2)16)10(21-7(3)17)11(22-8(4)18)12(19-5)14-15-13/h5,9-12H,1-4H3/t5-,9+,10+,11-,12+/m0/s1

2,3,4-Tri-O-acetyl-b-L-fucopyranosyl azide

CAS: 95581-07-0

Ref: 7W-GC2056

2,3,4-Tri-O-acetyl-β-L-fucopyranosyl azide

CAS: 95581-07-0

2,3,4-Tri-O-acetyl-β-L-fucopyranosyl azide

Molecular weight: 315.27928g/mol

Ref: 54-BICL2535

2,3,4-Tri-O-acetyl-b-L-fucopyranosyl azide

CAS: 95581-07-0

2,3,4-tri-O-acetyl-b-L-fucopyranosyl azide is a synthetic molecule that has been modified with fluorination, methylation, and acetylation. This compound is used for the synthesis of oligosaccharides and polysaccharides. It also can be used for glycosylation reactions to produce saccharides. The CAS number for this product is 95581-07-0.

Formula: C₁₂H₁₇N₃O₇

Purity: Min. 95%

Color and Shape: Light (Or Pale) Yellow Solid

Molecular weight: 315.28 g/mol

Ref: 3D-MT01052