CAS 95591-73-4

1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazine

Description:

1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)piperazine, with the CAS number 95591-73-4, is a chemical compound characterized by its unique structural features, which include a piperazine ring and a sulfonyl group attached to a benzodioxin moiety. This compound typically exhibits properties associated with both the piperazine and benzodioxin functionalities, such as potential biological activity and solubility in organic solvents. The presence of the sulfonyl group may enhance its reactivity and influence its interactions with biological targets. Compounds of this nature are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which can affect its stability and reactivity. Overall, this compound represents a class of organic molecules that may have significant implications in drug development and chemical research.

Formula: C₁₂H₁₆N₂O₄S

InChI: InChI=1/C12H16N2O4S/c15-19(16,14-5-3-13-4-6-14)10-1-2-11-12(9-10)18-8-7-17-11/h1-2,9,13H,3-8H2

SMILES: c1cc2c(cc1S(=O)(=O)N1CCNCC1)OCCO2

Synonyms:

• 1-(2,3-Dihydro-benzo[1,4]dioxine-6-sulfonyl)-piperazine

1-(2,3-Dihydro-benzo[1,4]dioxine-6-sulfonyl)-piperazine

CAS: 95591-73-4

Purity: 98%

Color and Shape: Solid

Molecular weight: 284.3299865722656

Ref: 10-F019993

1-(2,3-Dihydro-1,4-benzodioxine-6-sulfonyl)piperazine

CAS: 95591-73-4

Versatile small molecule scaffold

Formula: C₁₂H₁₆N₂O₄S

Purity: Min. 95%

Molecular weight: 284.33 g/mol

Ref: 3D-VDA59173