CymitQuimica logo

CAS 955929-54-1

:

Methyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate

Description:
Methyl 2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, with the CAS number 955929-54-1, is an organic compound characterized by its complex structure that includes a benzoate moiety and a dioxaborolane group. This compound typically exhibits properties associated with both aromatic and boron-containing compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the boron atom. The dioxaborolane group can participate in various chemical reactions, including cross-coupling reactions, making it valuable in synthetic organic chemistry, particularly in the formation of carbon-carbon bonds. Additionally, the presence of the methyl groups contributes to its steric properties and may influence its reactivity and stability. Overall, this compound is of interest in the fields of medicinal chemistry and materials science, where boron-containing compounds are often utilized for their unique chemical properties.
Formula:C15H21BO4
InChI:InChI=1S/C15H21BO4/c1-10-11(13(17)18-6)8-7-9-12(10)16-19-14(2,3)15(4,5)20-16/h7-9H,1-6H3
InChI key:ZEWWIRVGQHLZJP-UHFFFAOYSA-N
SMILES:Cc1c(cccc1B1OC(C)(C)C(C)(C)O1)C(=O)OC
Found 4 products.