CAS 955963-41-4

1-[4-(2-Thienyl)-2-thiazolyl]-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid

Description:

1-[4-(2-Thienyl)-2-thiazolyl]-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazole ring substituted with a trifluoromethyl group and a carboxylic acid functional group. The presence of a thienyl group and a thiazole moiety contributes to its unique chemical properties and potential biological activity. This compound is typically used in research settings, particularly in medicinal chemistry, due to its potential as a pharmacological agent. Its trifluoromethyl group enhances lipophilicity, which can influence its bioavailability and interaction with biological targets. The carboxylic acid functionality may also play a role in solubility and reactivity. Overall, this compound's structural features suggest it may exhibit interesting properties, making it a subject of interest for further studies in drug development and other applications in chemistry.

Formula: C₁₂H₆F₃N₃O₂S₂

InChI: InChI=1S/C12H6F3N3O2S2/c13-12(14,15)9-6(10(19)20)4-16-18(9)11-17-7(5-22-11)8-2-1-3-21-8/h1-5H,(H,19,20)

InChI key: InChIKey=VDBHEQWWNJWTBU-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1N(N=CC1C(O)=O)C2=NC(=CS2)C3=CC=CS3

Synonyms:

• 1-[4-(2-Thienyl)-2-thiazolyl]-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
• 1H-Pyrazole-4-carboxylic acid, 1-[4-(2-thienyl)-2-thiazolyl]-5-(trifluoromethyl)-