CAS 955963-47-0

2-[[1-(4-Methylphenyl)-1H-pyrazol-4-yl]carbonyl]phenyl 2-furancarboxylate

Description:

2-[[1-(4-Methylphenyl)-1H-pyrazol-4-yl]carbonyl]phenyl 2-furancarboxylate is a complex organic compound characterized by its unique structural features, which include a pyrazole ring, a phenyl group, and a furan moiety. This compound typically exhibits properties associated with its functional groups, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the pyrazole ring suggests possible applications in pharmaceuticals, particularly in the development of anti-inflammatory or analgesic agents. The furan carboxylate group may contribute to its reactivity and solubility in organic solvents. Additionally, the methyl substitution on the phenyl ring can influence the compound's electronic properties and steric hindrance, potentially affecting its interactions with biological targets. Overall, this compound's intricate structure and functional diversity make it a subject of interest for further research in various chemical and biological applications.

Formula: C₂₂H₁₆N₂O₄

InChI: InChI=1S/C22H16N2O4/c1-15-8-10-17(11-9-15)24-14-16(13-23-24)21(25)18-5-2-3-6-19(18)28-22(26)20-7-4-12-27-20/h2-14H,1H3

InChI key: InChIKey=AWIHJWYXVTYAMG-UHFFFAOYSA-N

SMILES: C(=O)(C1=CN(N=C1)C2=CC=C(C)C=C2)C3=C(OC(=O)C4=CC=CO4)C=CC=C3

Synonyms:

• 2-Furancarboxylic acid, 2-[[1-(4-methylphenyl)-1H-pyrazol-4-yl]carbonyl]phenyl ester
• 2-[[1-(4-Methylphenyl)-1H-pyrazol-4-yl]carbonyl]phenyl 2-furancarboxylate