CAS 955964-67-7

2-[1-Methyl-5-(trifluoromethyl)-1H-pyrazol-4-yl]-6-(phenylsulfonyl)pyrazolo[1,5-a]pyrimidin-7-amine

Description:

The chemical substance known as 2-[1-Methyl-5-(trifluoromethyl)-1H-pyrazol-4-yl]-6-(phenylsulfonyl)pyrazolo[1,5-a]pyrimidin-7-amine, with the CAS number 955964-67-7, is a complex organic compound characterized by its multi-ring structure, which includes pyrazole and pyrimidine moieties. This compound features a trifluoromethyl group, which enhances its lipophilicity and may influence its biological activity. The presence of a phenylsulfonyl group suggests potential for interactions with biological targets, possibly serving as a pharmacophore in medicinal chemistry. The compound's molecular structure indicates it may exhibit specific properties such as solubility in organic solvents and potential reactivity due to the functional groups present. Its unique arrangement of atoms and functional groups may contribute to its potential applications in pharmaceuticals, particularly in the development of targeted therapies. As with many complex organic compounds, its behavior in biological systems would depend on factors such as stability, metabolism, and interaction with biological macromolecules.

Formula: C₁₇H₁₃F₃N₆O₂S

InChI: InChI=1S/C17H13F3N6O2S/c1-25-15(17(18,19)20)11(8-23-25)12-7-14-22-9-13(16(21)26(14)24-12)29(27,28)10-5-3-2-4-6-10/h2-9H,21H2,1H3

InChI key: InChIKey=QJRKCSHCPKYFEW-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(C=NN1C)C2=NN3C(=C2)N=CC(S(=O)(=O)C4=CC=CC=C4)=C3N

Synonyms:

• Pyrazolo[1,5-a]pyrimidin-7-amine, 2-[1-methyl-5-(trifluoromethyl)-1H-pyrazol-4-yl]-6-(phenylsulfonyl)-
• 2-[1-Methyl-5-(trifluoromethyl)-1H-pyrazol-4-yl]-6-(phenylsulfonyl)pyrazolo[1,5-a]pyrimidin-7-amine