
CAS 955966-44-6
:2-[3-Methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]-4-thiazolecarboxylic acid 2-[thioxo[[3-(trifluoromethyl)phenyl]amino]methyl]hydrazide
Description:
The chemical substance known as "2-[3-Methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]-4-thiazolecarboxylic acid 2-[thioxo[[3-(trifluoromethyl)phenyl]amino]methyl]hydrazide," with the CAS number 955966-44-6, is a complex organic compound characterized by its unique structural features. It contains a thiazole ring, a pyrazole moiety, and a hydrazide functional group, which contribute to its potential biological activity. The presence of trifluoromethyl groups enhances its lipophilicity and may influence its pharmacokinetic properties. This compound is likely to exhibit interesting interactions with biological targets due to its diverse functional groups, making it a candidate for research in medicinal chemistry. Its synthesis involves multiple steps, typically requiring careful control of reaction conditions to ensure the desired product is obtained. The compound's solubility, stability, and reactivity would depend on the specific functional groups and their arrangement within the molecular structure, which can also affect its potential applications in pharmaceuticals or agrochemicals. Further studies would be necessary to elucidate its biological activity and potential therapeutic uses.
Formula:C17H12F6N6OS2
InChI:InChI=1S/C17H12F6N6OS2/c1-8-5-12(17(21,22)23)29(28-8)15-25-11(7-32-15)13(30)26-27-14(31)24-10-4-2-3-9(6-10)16(18,19)20/h2-7H,1H3,(H,26,30)(H2,24,27,31)
InChI key:InChIKey=DDXDZKIQPPOFCK-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N(N=C(C)C1)C2=NC(C(NNC(NC3=CC(C(F)(F)F)=CC=C3)=S)=O)=CS2
Synonyms:- 2-[3-Methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]-4-thiazolecarboxylic acid 2-[thioxo[[3-(trifluoromethyl)phenyl]amino]methyl]hydrazide
- 4-Thiazolecarboxylic acid, 2-[3-methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]-, 2-[thioxo[[3-(trifluoromethyl)phenyl]amino]methyl]hydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.