CymitQuimica logo

CAS 955966-60-6

:

4-[4-[1-(4-Fluorophenyl)-1H-pyrazol-5-yl]phenyl]morpholine

Description:
4-[4-[1-(4-Fluorophenyl)-1H-pyrazol-5-yl]phenyl]morpholine, identified by its CAS number 955966-60-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a morpholine ring and a pyrazole moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the fluorophenyl group may enhance its lipophilicity and influence its interaction with biological targets. Additionally, the morpholine ring contributes to its potential as a pharmacophore, which can facilitate binding to specific receptors or enzymes. The compound's unique structure suggests it may possess specific therapeutic properties, possibly in the realm of anti-inflammatory or analgesic activities, although detailed biological evaluations would be necessary to confirm such effects. Overall, 4-[4-[1-(4-Fluorophenyl)-1H-pyrazol-5-yl]phenyl]morpholine represents a valuable subject for further investigation in medicinal chemistry and drug development.
Formula:C19H18FN3O
InChI:InChI=1S/C19H18FN3O/c20-16-3-7-18(8-4-16)23-19(9-10-21-23)15-1-5-17(6-2-15)22-11-13-24-14-12-22/h1-10H,11-14H2
InChI key:InChIKey=OXRIVEAPYVYEFT-UHFFFAOYSA-N
SMILES:FC1=CC=C(N2C(=CC=N2)C3=CC=C(C=C3)N4CCOCC4)C=C1
Synonyms:
  • 4-[4-[1-(4-Fluorophenyl)-1H-pyrazol-5-yl]phenyl]morpholine
  • Morpholine, 4-[4-[1-(4-fluorophenyl)-1H-pyrazol-5-yl]phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.