CymitQuimica logo

CAS 955966-80-0

:

4-(4-Fluorophenyl)-1-[4-(4-fluorophenyl)-2-thiazolyl]-1H-pyrazol-5-amine

Description:
4-(4-Fluorophenyl)-1-[4-(4-fluorophenyl)-2-thiazolyl]-1H-pyrazol-5-amine, with the CAS number 955966-80-0, is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a thiazole moiety, and multiple fluorophenyl groups. This compound typically exhibits properties such as moderate to high solubility in organic solvents, and its molecular structure suggests potential for biological activity, particularly in medicinal chemistry. The presence of fluorine atoms can enhance lipophilicity and metabolic stability, making it a candidate for drug development. Additionally, the thiazole and pyrazole rings may contribute to its ability to interact with biological targets, potentially influencing its pharmacological profile. The compound's synthesis and characterization would involve standard organic chemistry techniques, and its reactivity may be influenced by the electron-withdrawing nature of the fluorine substituents. Overall, this compound represents a class of heterocyclic compounds that are of interest in various fields, including pharmaceuticals and agrochemicals.
Formula:C18H12F2N4S
InChI:InChI=1S/C18H12F2N4S/c19-13-5-1-11(2-6-13)15-9-22-24(17(15)21)18-23-16(10-25-18)12-3-7-14(20)8-4-12/h1-10H,21H2
InChI key:InChIKey=KHHROYQQNPKBFU-UHFFFAOYSA-N
SMILES:NC=1N(N=CC1C2=CC=C(F)C=C2)C3=NC(=CS3)C4=CC=C(F)C=C4
Synonyms:
  • 1H-Pyrazol-5-amine, 4-(4-fluorophenyl)-1-[4-(4-fluorophenyl)-2-thiazolyl]-
  • 4-(4-Fluorophenyl)-1-[4-(4-fluorophenyl)-2-thiazolyl]-1H-pyrazol-5-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.