CAS 955976-58-6

4-[4-[(4-Fluorophenyl)methyl]-5-methyl-4H-1,2,4-triazol-3-yl]-1-methyl-1H-pyrazol-5-amine

Description:

4-[4-[(4-Fluorophenyl)methyl]-5-methyl-4H-1,2,4-triazol-3-yl]-1-methyl-1H-pyrazol-5-amine is a chemical compound characterized by its complex structure, which includes a triazole and pyrazole moiety. This compound features a fluorophenyl group, contributing to its potential biological activity. The presence of multiple functional groups suggests that it may exhibit diverse interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The molecular structure indicates potential for hydrogen bonding and other intermolecular interactions, which can influence its solubility, stability, and reactivity. Additionally, the specific arrangement of atoms and functional groups may impart unique pharmacokinetic properties, affecting absorption, distribution, metabolism, and excretion (ADME) profiles. The compound's CAS number, 955976-58-6, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, this compound's characteristics suggest it may have applications in therapeutic areas, although further studies would be necessary to elucidate its specific biological effects and mechanisms of action.

Formula: C₁₄H₁₅FN₆

InChI: InChI=1S/C14H15FN6/c1-9-18-19-14(12-7-17-20(2)13(12)16)21(9)8-10-3-5-11(15)6-4-10/h3-7H,8,16H2,1-2H3

InChI key: InChIKey=XTVWGNAUTQYVGD-UHFFFAOYSA-N

SMILES: C(N1C(=NN=C1C)C2=C(N)N(C)N=C2)C3=CC=C(F)C=C3

Synonyms:

• 1H-Pyrazol-5-amine, 4-[4-[(4-fluorophenyl)methyl]-5-methyl-4H-1,2,4-triazol-3-yl]-1-methyl-
• 4-[4-[(4-Fluorophenyl)methyl]-5-methyl-4H-1,2,4-triazol-3-yl]-1-methyl-1H-pyrazol-5-amine