
CAS 955976-94-0
:2-[3-Methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]-4-phenyl-5-thiazoleacetic acid
Description:
2-[3-Methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]-4-phenyl-5-thiazoleacetic acid is a chemical compound characterized by its complex structure, which includes a thiazole ring, a pyrazole moiety, and a phenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the trifluoromethyl group often enhances lipophilicity and can influence the compound's interaction with biological targets. Additionally, the thiazole and pyrazole rings contribute to its potential as a ligand in various chemical reactions or as a precursor in synthetic pathways. The compound may also display specific reactivity patterns due to the functional groups present, which can be exploited in medicinal chemistry for developing new therapeutic agents. Overall, its unique structural features suggest a range of applications in drug discovery and development, particularly in areas targeting inflammation or other biological processes.
Formula:C16H12F3N3O2S
InChI:InChI=1S/C16H12F3N3O2S/c1-9-7-12(16(17,18)19)22(21-9)15-20-14(10-5-3-2-4-6-10)11(25-15)8-13(23)24/h2-7H,8H2,1H3,(H,23,24)
InChI key:InChIKey=WSOPRNHDAVUOMT-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N(N=C(C)C1)C2=NC(=C(CC(O)=O)S2)C3=CC=CC=C3
Synonyms:- 5-Thiazoleacetic acid, 2-[3-methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]-4-phenyl-
- 2-[3-Methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]-4-phenyl-5-thiazoleacetic acid
- 2-(2-[3-METHYL-5-(TRIFLUOROMETHYL)-1H-PYRAZOL-1-YL]-4-PHENYL-1,3-THIAZOL-5-YL)ACETIC ACID
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.