CymitQuimica logo

CAS 955978-76-4

:

N-(3-Bromo-2-methylphenyl)-2,2,2-trifluoroacetamide

Description:
N-(3-Bromo-2-methylphenyl)-2,2,2-trifluoroacetamide is an organic compound characterized by its unique structure, which includes a brominated aromatic ring and a trifluoroacetamide functional group. The presence of the bromine atom introduces significant electronegativity, influencing the compound's reactivity and potential applications in medicinal chemistry. The trifluoroacetamide moiety enhances the compound's lipophilicity and stability, making it suitable for various chemical reactions and interactions. This compound may exhibit interesting biological activities due to its structural features, which can affect its binding affinity to biological targets. Additionally, the trifluoromethyl group is known for imparting unique properties such as increased metabolic stability and altered pharmacokinetics. Overall, N-(3-Bromo-2-methylphenyl)-2,2,2-trifluoroacetamide represents a versatile building block in organic synthesis and drug development, with potential implications in the fields of pharmaceuticals and agrochemicals. Its specific characteristics, including solubility, melting point, and spectral properties, would typically be determined through experimental methods.
Formula:C9H7BrF3NO
InChI:InChI=1S/C9H7BrF3NO/c1-5-6(10)3-2-4-7(5)14-8(15)9(11,12)13/h2-4H,1H3,(H,14,15)
InChI key:InChIKey=ABHOOAGCJXUGKR-UHFFFAOYSA-N
SMILES:N(C(C(F)(F)F)=O)C1=C(C)C(Br)=CC=C1
Synonyms:
  • 2,2,2-Trifluoro-N-(3-bromo-2-methylphenyl)acetamide
  • Acetamide, N-(3-bromo-2-methylphenyl)-2,2,2-trifluoro-
  • N-(3-Bromo-2-methylphenyl)-2,2,2-trifluoroacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.