
CAS 955978-79-7
:6-(Trifluoromethyl)-1H-indol-4-amine
Description:
6-(Trifluoromethyl)-1H-indol-4-amine is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a trifluoromethyl group (-CF3) at the 6-position of the indole ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The amine group at the 4-position introduces basicity and can participate in hydrogen bonding, making the compound of interest in medicinal chemistry and drug design. This compound may exhibit unique reactivity due to the electron-withdrawing nature of the trifluoromethyl group, which can stabilize certain intermediates or influence reaction pathways. Additionally, its structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many indole derivatives, it may also display interesting pharmacological properties, including anti-inflammatory or anticancer activities, warranting further investigation in research settings.
Formula:C9H7F3N2
InChI:InChI=1S/C9H7F3N2/c10-9(11,12)5-3-7(13)6-1-2-14-8(6)4-5/h1-4,14H,13H2
InChI key:InChIKey=ONVVTROMZJFDCL-UHFFFAOYSA-N
SMILES:NC1=C2C(=CC(C(F)(F)F)=C1)NC=C2
Synonyms:- 1H-Indol-4-amine, 6-(trifluoromethyl)-
- 6-Trifluoromethyl-1H-indol-4-ylamine
- 6-(Trifluoromethyl)-1H-indol-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.