CAS 956015-51-3

2-[(2-Fluoro-4-nitrophenoxy)methyl]tetrahydrofuran

Description:

2-[(2-Fluoro-4-nitrophenoxy)methyl]tetrahydrofuran is an organic compound characterized by its unique molecular structure, which includes a tetrahydrofuran ring and a phenoxy group substituted with a fluorine and a nitro group. The presence of the tetrahydrofuran moiety contributes to its cyclic ether properties, providing a degree of flexibility and potential for solubility in various organic solvents. The fluorine atom enhances the compound's lipophilicity, while the nitro group can impart polar characteristics, influencing its reactivity and interaction with biological systems. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further research in medicinal chemistry. Additionally, the specific arrangement of functional groups can affect its stability, reactivity, and potential applications in synthesis or as an intermediate in the development of more complex molecules. As with many organic compounds, safety and handling precautions should be observed, particularly due to the presence of the nitro group, which can be associated with explosive properties under certain conditions.

Formula: C₁₁H₁₂FNO₄

InChI: InChI=1S/C11H12FNO4/c12-10-6-8(13(14)15)3-4-11(10)17-7-9-2-1-5-16-9/h3-4,6,9H,1-2,5,7H2

InChI key: InChIKey=OISHSMPORQLPPV-UHFFFAOYSA-N

SMILES: O(CC1CCCO1)C2=C(F)C=C(N(=O)=O)C=C2

Synonyms:

• 2-[(2-Fluoro-4-nitrophenoxy)methyl]oxolane
• Furan, 2-[(2-fluoro-4-nitrophenoxy)methyl]tetrahydro-
• 2-[(2-Fluoro-4-nitrophenoxy)methyl]tetrahydrofuran

2-[(2-Fluoro-4-nitrophenoxy)methyl]tetrahydrofuran

CAS: 956015-51-3

Formula: C₁₁H₁₂FNO₄

Purity: 95.0%

Molecular weight: 241.218

Ref: 10-F063443