CymitQuimica logo

CAS 956018-34-1

:

tert-butyl N-[2-(2-aminothiazol-4-yl)ethyl]carbamate

Description:
Tert-butyl N-[2-(2-aminothiazol-4-yl)ethyl]carbamate is a chemical compound characterized by its structure, which includes a tert-butyl group, a carbamate functional group, and a thiazole derivative. This compound typically exhibits properties associated with both organic amines and carbamates, such as moderate solubility in organic solvents and potential reactivity with electrophiles due to the presence of the amino group. The thiazole ring contributes to its biological activity, often enhancing its interaction with biological targets, making it of interest in medicinal chemistry. The compound may also display specific pharmacological properties, which can be influenced by the substituents on the thiazole and the overall molecular configuration. Its CAS number, 956018-34-1, allows for precise identification in chemical databases, facilitating research and development in various applications, including drug discovery and agrochemicals. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C10H17N3O2S
InChI:InChI=1/C10H17N3O2S/c1-10(2,3)15-9(14)12-5-4-7-6-16-8(11)13-7/h6H,4-5H2,1-3H3,(H2,11,13)(H,12,14)
SMILES:CC(C)(C)OC(=NCCc1csc(=N)[nH]1)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.