CAS 95602-96-3
:N-(chloroacetyl)-N-hydroxy-L-isoleucyl-L-alanylglycinamide
Description:
N-(Chloroacetyl)-N-hydroxy-L-isoleucyl-L-alanylglycinamide, with the CAS number 95602-96-3, is a synthetic compound that belongs to the class of peptide derivatives. This substance features a chloroacetyl group, which is known for its reactivity, particularly in acylation reactions. The presence of the hydroxy group contributes to its potential as a nucleophile, enhancing its reactivity in various chemical processes. The compound is characterized by its amino acid components, specifically L-isoleucine, L-alanine, and glycine, which suggest that it may exhibit biological activity, potentially influencing peptide synthesis or acting as a bioactive molecule. Its structure implies that it may participate in interactions with biological targets, making it of interest in medicinal chemistry and drug development. Additionally, the presence of the chloroacetyl moiety may impart specific pharmacological properties, such as increased lipophilicity or the ability to form covalent bonds with biological macromolecules. Overall, this compound's unique structural features position it as a candidate for further research in biochemical applications.
Formula:C13H23ClN4O5
InChI:InChI=1/C13H23ClN4O5/c1-4-7(2)11(18(23)10(20)5-14)13(22)17-8(3)12(21)16-6-9(15)19/h7-8,11,23H,4-6H2,1-3H3,(H2,15,19)(H,16,21)(H,17,22)/t7?,8-,11-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Cl-Ac-(OH)Leu-Ala-Gly-NH2
CAS:Cl-Ac-(OH)Leu-Ala-Gly-NH2 is a peptide with an amino acid composition of Cl-Ac-(OH)Leu-Ala-Gly. It is synthesized by the chemical reaction of hydrochloric acid and L-alanine. This peptide has been shown to be an irreversible inhibitor of metalloendopeptidase, preventing the breakdown of proteins in the stomach. The pH profile for this peptide is acidic and its molecular weight is approximately 1296 daltons.Formula:C13H23N4O5ClPurity:Min. 95%Molecular weight:350.8 g/molCl-Ac-(OH)Leu-Ala-Gly-NH₂
CAS:Cl-Ac-(OH)Leu-Ala-Gly-NH₂ is a peptide with a molecular weight of 736.2 Da. It is an inhibitor of the enzyme protein kinase C (PKC). Cl-Ac-(OH)Leu-Ala-Gly-NH₂ has been shown to activate PKC by binding to specific domains in the enzyme, which leads to the phosphorylation and activation of PKC's regulatory subunits. This peptide can be used as a research tool in studies involving PKC and also as an antibody carrier for Western blotting and immunohistochemistry.
Formula:C13H23N4O5ClPurity:Min. 95%Molecular weight:350.8 g/mol
