CAS 956034-04-1

2-Furancarboxylic acid, 3-amino-, methyl ester

Description:

2-Furancarboxylic acid, 3-amino-, methyl ester, also known as methyl 3-amino-2-furoate, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a carboxylic acid functional group and an amino group, contributing to its reactivity and potential applications in organic synthesis. The methyl ester group enhances its solubility in organic solvents and may influence its biological activity. Typically, compounds of this nature exhibit moderate polarity, making them suitable for various chemical reactions, including esterification and amidation. The presence of the amino group can also facilitate interactions with biological systems, suggesting potential applications in pharmaceuticals or agrochemicals. Additionally, the compound's structure allows for various modifications, which can lead to derivatives with tailored properties. As with many furan derivatives, it may exhibit interesting properties such as antioxidant activity or antimicrobial effects, making it a subject of interest in medicinal chemistry and materials science.

Formula: C₆H₇NO₃

InChI: InChI=1S/C6H7NO3/c1-9-6(8)5-4(7)2-3-10-5/h2-3H,7H2,1H3

InChI key: InChIKey=UTLPWTWCOSOPMX-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=C(N)C=CO1

Synonyms:

• 2-Furancarboxylic Acid, 3-Amino-, Methyl Ester
• Methyl 3-aminofuran-2-carboxylate

Methyl 3-aminofuran-2-carboxylate

CAS: 956034-04-1

Formula: C₆H₇NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 141.1247

Ref: IN-DA00H8RA

Methyl 3-aminofuran-2-carboxylate

CAS: 956034-04-1

Methyl 3-aminofuran-2-carboxylate

Purity: 99%

Molecular weight: 141.12g/mol

Ref: 54-OR75982

Methyl 3-aminofuran-2-carboxylate

CAS: 956034-04-1

Formula: C₆H₇NO₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 141.126

Ref: 10-F077052