CAS 956034-07-4

2,4-Dichlorofuro[3,2-d]pyrimidine

Description:

2,4-Dichlorofuro[3,2-d]pyrimidine is a heterocyclic compound characterized by its fused ring structure, which incorporates both furan and pyrimidine moieties. This compound features two chlorine substituents at the 2 and 4 positions of the pyrimidine ring, contributing to its chemical reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of chlorine atoms can enhance its lipophilicity and influence its interactions with biological targets. 2,4-Dichlorofuro[3,2-d]pyrimidine may be of interest in medicinal chemistry and agricultural applications due to its potential as a building block for the synthesis of pharmaceuticals or agrochemicals. Its unique structure may also impart specific properties, such as antimicrobial or herbicidal activity, although detailed studies would be necessary to elucidate its full range of biological effects. As with all chemical substances, proper handling and safety precautions should be observed due to potential toxicity or environmental impact.

Formula: C₆H₂Cl₂N₂O

InChI: InChI=1/C6H2Cl2N2O/c7-5-4-3(1-2-11-4)9-6(8)10-5/h1-2H

SMILES: c1coc2c1nc(Cl)nc2Cl

Synonyms:

• Furo[3,2-D]Pyrimidine, 2,4-Dichloro-

2,4-Dichlorofuro[3,2-d]pyrimidine

CAS: 956034-07-4

Formula: C₆H₂Cl₂N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.9989

Ref: IN-DA00H8R9

2,4-Dichlorofuro[3,2-d]pyrimidine

CAS: 956034-07-4

2,4-Dichlorofuro[3,2-d]pyrimidine

Purity: 97%

Color and Shape: Solid

Molecular weight: 189.00g/mol

Ref: 54-OR926903

2,4-Dichlorofuro[3,2-d]pyrimidine

CAS: 956034-07-4

Formula: C₆H₂Cl₂N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 189

Ref: 10-F076777