CAS 95606-81-8

1-(3-methylphenyl)-2-phenylethanone

Description:

1-(3-Methylphenyl)-2-phenylethanone, also known as benzyl methyl ketone, is an organic compound characterized by its ketone functional group. It features a central carbonyl group (C=O) flanked by two aromatic rings, specifically a 3-methylphenyl group and a phenyl group. This structure contributes to its relatively high stability and moderate reactivity typical of ketones. The compound is typically a colorless to pale yellow liquid with a pleasant aromatic odor, making it useful in various applications, including as a fragrance or flavoring agent. It has a moderate boiling point and is soluble in organic solvents, but its solubility in water is limited due to the hydrophobic nature of the aromatic rings. Additionally, 1-(3-methylphenyl)-2-phenylethanone may exhibit photochemical properties, making it of interest in photoinitiator applications in polymer chemistry. Safety data should be consulted, as with all chemical substances, to understand its handling and potential hazards.

Formula: C₁₅H₁₄O

InChI: InChI=1/C15H14O/c1-12-6-5-9-14(10-12)15(16)11-13-7-3-2-4-8-13/h2-10H,11H2,1H3

SMILES: Cc1cccc(c1)C(=O)Cc1ccccc1