
CAS 95611-20-4
:Boronic acid, phenyl-, dioctadecyl ester
Description:
Boronic acid, phenyl-, dioctadecyl ester, with the CAS number 95611-20-4, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring and esterified with dioctadecyl chains. This compound typically exhibits low solubility in water due to its long hydrophobic alkyl chains, which enhances its compatibility with organic solvents. The boronic acid moiety allows for potential reactivity in various chemical transformations, including Suzuki coupling reactions, making it valuable in organic synthesis and materials science. Its structure suggests that it may possess amphiphilic properties, enabling it to interact with both polar and nonpolar environments. Additionally, the presence of the phenyl group can contribute to its stability and influence its electronic properties. Overall, this compound is of interest in fields such as organic chemistry, polymer science, and potentially in drug delivery systems due to its unique structural features and reactivity.
Formula:C42H79BO2
InChI:InChI=1S/C42H79BO2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-36-40-44-43(42-38-34-33-35-39-42)45-41-37-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h33-35,38-39H,3-32,36-37,40-41H2,1-2H3
InChI key:InChIKey=XVGMCEZKIXZSPP-UHFFFAOYSA-N
SMILES:B(OCCCCCCCCCCCCCCCCCC)(OCCCCCCCCCCCCCCCCCC)C1=CC=CC=C1
Synonyms:- Boronic acid, phenyl-, dioctadecyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
