CymitQuimica logo

CAS 95611-88-4

:

5-(4-chloro-2-nitrophenyl)-2-furoic acid

Description:
5-(4-Chloro-2-nitrophenyl)-2-furoic acid is an organic compound characterized by its furoic acid backbone, which is a five-membered aromatic ring containing an oxygen atom. The presence of a 4-chloro-2-nitrophenyl group indicates that the compound has both chlorine and nitro substituents on the phenyl ring, contributing to its chemical reactivity and potential applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its functional groups suggest that it could participate in various chemical reactions, such as electrophilic substitution or nucleophilic attack, making it of interest in synthetic organic chemistry. Additionally, the presence of the nitro group may impart specific electronic properties, influencing its behavior in biological systems or as a potential pharmaceutical agent. Safety and handling precautions should be observed due to the presence of chlorine and nitro groups, which can be hazardous. Overall, 5-(4-chloro-2-nitrophenyl)-2-furoic acid is a compound with notable chemical characteristics that may be explored for various applications in research and industry.
Formula:C11H6ClNO5
InChI:InChI=1/C11H6ClNO5/c12-6-1-2-7(8(5-6)13(16)17)9-3-4-10(18-9)11(14)15/h1-5H,(H,14,15)
SMILES:c1cc(c(cc1Cl)N(=O)=O)c1ccc(C(=O)O)o1
Synonyms:
  • 5-(4-Chloro-2-Nitrophenyl)Furan-2-Carboxylic Acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.