CymitQuimica logo

CAS 956139-21-2

:

Morpholino C subunit

Description:
Morpholino C subunit, identified by its CAS number 956139-21-2, is a synthetic organic compound that belongs to the class of morpholino derivatives. Morpholinos are known for their unique structure, which includes a six-membered ring containing one nitrogen atom and five carbon atoms, along with an ether linkage. This compound is characterized by its ability to form stable complexes with nucleic acids, making it particularly useful in molecular biology and genetic research. Morpholino C subunit is often employed as an antisense oligonucleotide, where it can effectively modulate gene expression by binding to specific RNA sequences, thereby inhibiting translation or splicing. Its stability against nucleases and low toxicity profile further enhance its utility in therapeutic applications. Additionally, the compound's solubility in aqueous solutions and compatibility with various biological systems make it a valuable tool in the development of gene-targeting strategies. Overall, the Morpholino C subunit represents a significant advancement in the field of nucleic acid chemistry and molecular therapeutics.
Formula:C37H37ClN5O5P
InChI:InChI=1S/C37H37ClN5O5P/c1-41(2)49(38,46)47-27-32-25-42(26-34(48-32)43-24-23-33(40-36(43)45)39-35(44)28-15-7-3-8-16-28)37(29-17-9-4-10-18-29,30-19-11-5-12-20-30)31-21-13-6-14-22-31/h3-24,32,34H,25-27H2,1-2H3,(H,39,40,44,45)/t32-,34+,49?/m0/s1
InChI key:RCQVHNTXMQCQLT-AUIRFOQBSA-N
SMILES:CN(C)P(=O)(OC[C@@H]1CN(C[C@@H](O1)N2C=CC(=NC2=O)NC(=O)C3=CC=CC=C3)C(C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)Cl
Synonyms:
  • 6-(4-benzamido-2-oxopyrimidin-1(2H)-yl)-4-tritylmorpholin-2-yl)methyl Dimethylphosphoramidochloridate
Found 6 products.