
CAS 956141-86-9
:5-Bromo-2,3-dihydrospiro[1H-indene-1,3′-pyrrolidine]
Description:
5-Bromo-2,3-dihydrospiro[1H-indene-1,3′-pyrrolidine] is a chemical compound characterized by its unique spirocyclic structure, which combines an indene and a pyrrolidine moiety. The presence of a bromine atom at the 5-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. This compound typically exhibits a moderate level of solubility in organic solvents, reflecting its hydrophobic nature due to the fused ring system. Its molecular structure suggests potential for interesting electronic properties and biological activity, making it a candidate for further research in drug development. The compound's synthesis may involve multi-step reactions, including halogenation and cyclization processes. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 5-Bromo-2,3-dihydrospiro[1H-indene-1,3′-pyrrolidine] represents a fascinating subject for study in the fields of organic chemistry and pharmacology.
Formula:C12H14BrN
InChI:InChI=1S/C12H14BrN/c13-10-1-2-11-9(7-10)3-4-12(11)5-6-14-8-12/h1-2,7,14H,3-6,8H2
InChI key:InChIKey=XHFSYLGTPKUHTK-UHFFFAOYSA-N
SMILES:BrC=1C=C2C(C3(CC2)CCNC3)=CC1
Synonyms:- Spiro[1H-indene-1,3′-pyrrolidine], 5-bromo-2,3-dihydro-
- 5-Bromo-2,3-dihydrospiro[1H-indene-1,3′-pyrrolidine]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.