CymitQuimica logo

CAS 956193-65-0

:

4-Ethyl-2,4-dihydro-5-[2-[3-methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]-4-thiazolyl]-3H-1,2,4-triazole-3-thione

Description:
4-Ethyl-2,4-dihydro-5-[2-[3-methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]-4-thiazolyl]-3H-1,2,4-triazole-3-thione is a complex organic compound characterized by its multi-ring structure, which includes a triazole and thiazole moiety. This compound features a trifluoromethyl group, enhancing its lipophilicity and potentially influencing its biological activity. The presence of the ethyl group contributes to its steric properties, while the thione functional group may impart specific reactivity and stability characteristics. Typically, compounds of this nature are investigated for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the trifluoromethyl group is known to enhance metabolic stability and bioactivity, which can be advantageous in drug design. Overall, this compound exemplifies the complexity and diversity of modern synthetic organic chemistry, with implications for various fields including medicinal chemistry and material science.
Formula:C12H11F3N6S2
InChI:InChI=1S/C12H11F3N6S2/c1-3-20-9(17-18-10(20)22)7-5-23-11(16-7)21-8(12(13,14)15)4-6(2)19-21/h4-5H,3H2,1-2H3,(H,18,22)
InChI key:InChIKey=FOZGLWGFHDPQEU-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N(N=C(C)C1)C2=NC(=CS2)C=3N(CC)C(=S)NN3
Synonyms:
  • 3H-1,2,4-Triazole-3-thione, 4-ethyl-2,4-dihydro-5-[2-[3-methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]-4-thiazolyl]-
  • 4-Ethyl-2,4-dihydro-5-[2-[3-methyl-5-(trifluoromethyl)-1H-pyrazol-1-yl]-4-thiazolyl]-3H-1,2,4-triazole-3-thione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.