CymitQuimica logo

CAS 956193-98-9

:

4-[5-Methyl-4-(4-pyridinylmethyl)-4H-1,2,4-triazol-3-yl]-1-phenyl-1H-pyrazol-5-amine

Description:
The chemical substance known as 4-[5-Methyl-4-(4-pyridinylmethyl)-4H-1,2,4-triazol-3-yl]-1-phenyl-1H-pyrazol-5-amine, with the CAS number 956193-98-9, is a complex organic compound characterized by its multi-ring structure and the presence of various functional groups. It features a pyrazole ring, which is known for its biological activity, and a triazole moiety that contributes to its potential as a pharmacological agent. The presence of a pyridine group suggests possible interactions with biological targets, enhancing its utility in medicinal chemistry. This compound may exhibit properties such as anti-inflammatory or antifungal activity, making it of interest in drug development. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can influence its solubility and bioavailability. Overall, this compound represents a class of heterocyclic compounds that are often explored for their therapeutic potential in various diseases.
Formula:C18H17N7
InChI:InChI=1S/C18H17N7/c1-13-22-23-18(24(13)12-14-7-9-20-10-8-14)16-11-21-25(17(16)19)15-5-3-2-4-6-15/h2-11H,12,19H2,1H3
InChI key:InChIKey=DCPVTLDYHLTUSX-UHFFFAOYSA-N
SMILES:C(N1C(=NN=C1C)C2=C(N)N(N=C2)C3=CC=CC=C3)C=4C=CN=CC4
Synonyms:
  • 4-[5-Methyl-4-(4-pyridinylmethyl)-4H-1,2,4-triazol-3-yl]-1-phenyl-1H-pyrazol-5-amine
  • 1H-Pyrazol-5-amine, 4-[5-methyl-4-(4-pyridinylmethyl)-4H-1,2,4-triazol-3-yl]-1-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.