CymitQuimica logo

CAS 956193-99-0

:

1-Methyl-4-[5-methyl-4-(4-pyridinylmethyl)-4H-1,2,4-triazol-3-yl]-1H-pyrazol-5-amine

Description:
1-Methyl-4-[5-methyl-4-(4-pyridinylmethyl)-4H-1,2,4-triazol-3-yl]-1H-pyrazol-5-amine is a chemical compound characterized by its complex structure, which includes a pyrazole ring, a triazole moiety, and a pyridine substituent. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in pharmaceutical research. The presence of multiple nitrogen atoms in its rings may contribute to its ability to form hydrogen bonds, influencing its solubility and reactivity. Additionally, the methyl groups attached to the triazole and pyrazole rings can affect the compound's lipophilicity and overall stability. The specific arrangement of functional groups suggests that it may interact with biological targets, potentially serving as a lead compound in drug development. Its CAS number, 956193-99-0, allows for easy identification in chemical databases, facilitating research and development efforts. Overall, this compound exemplifies the intricate design often found in medicinal chemistry aimed at optimizing therapeutic efficacy.
Formula:C13H15N7
InChI:InChI=1S/C13H15N7/c1-9-17-18-13(11-7-16-19(2)12(11)14)20(9)8-10-3-5-15-6-4-10/h3-7H,8,14H2,1-2H3
InChI key:InChIKey=AWXCUBYDDVVRLA-UHFFFAOYSA-N
SMILES:C(N1C(=NN=C1C)C2=C(N)N(C)N=C2)C=3C=CN=CC3
Synonyms:
  • 1-Methyl-4-[5-methyl-4-(4-pyridinylmethyl)-4H-1,2,4-triazol-3-yl]-1H-pyrazol-5-amine
  • 1H-Pyrazol-5-amine, 1-methyl-4-[5-methyl-4-(4-pyridinylmethyl)-4H-1,2,4-triazol-3-yl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.