CAS 956204-54-9
:3-Methyl-4-nitro-1H-pyrazole-1-acetic acid
Description:
3-Methyl-4-nitro-1H-pyrazole-1-acetic acid is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a methyl group and a nitro group, which contribute to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the acetic acid functional group suggests that it can participate in acid-base reactions and may exhibit biological activity. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. The compound is typically synthesized through specific organic reactions that introduce the methyl and nitro substituents onto the pyrazole ring. As with many nitro-containing compounds, it may exhibit unique properties such as increased stability under certain conditions, but also potential toxicity, necessitating careful handling and assessment in laboratory settings. Overall, 3-Methyl-4-nitro-1H-pyrazole-1-acetic acid represents a versatile compound with significant implications in research and development.
Formula:C6H7N3O4
InChI:InChI=1S/C6H7N3O4/c1-4-5(9(12)13)2-8(7-4)3-6(10)11/h2H,3H2,1H3,(H,10,11)
InChI key:InChIKey=XIXBNMMGKJHUJH-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CN(CC(O)=O)N=C1C
Synonyms:- 1H-Pyrazole-1-acetic acid, 3-methyl-4-nitro-
- 3-Methyl-4-nitro-1H-pyrazole-1-acetic acid
- 2-(3-Methyl-4-nitro-1H-pyrazol-1-yl)acetic acid
- (3-Methyl-4-nitro-pyrazol-1-yl)-acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
